C20H19ClN2O4S — CID 22777126
2-chloro-5-[2-[4-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 22777126) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is 2-chloro-5-[2-[4-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[2-[4-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 22777126 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-chloro-5-[2-[4-(cyclopropanecarbonylamino)phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)C2CC2)cc1)C(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-11(18(24)23-14-6-9-17(21)16(10-14)20(26)27)28-15-7-4-13(5-8-15)22-19(25)12-2-3-12/h4-12H,2-3H2,1H3,(H,22,25)(H,23,24)(H,26,27) |
| InChIKey | JCNNSVPXVUKCFX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |