C23H26N2O5S — CID 22781481
5-[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid (PubChem CID 22781481) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22781481 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-[2-[4-(cyclohexanecarbonylamino)phenyl]sulfanylpropanoylamino]-2-hydroxybenzoic acid |
| SMILES | CC(Sc1ccc(NC(=O)C2CCCCC2)cc1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H26N2O5S/c1-14(21(27)25-17-9-12-20(26)19(13-17)23(29)30)31-18-10-7-16(8-11-18)24-22(28)15-5-3-2-4-6-15/h7-15,26H,2-6H2,1H3,(H,24,28)(H,25,27)(H,29,30) |
| InChIKey | NZORGLNTIABMGV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|