C33H34N2O6S — CID 18896403
6-[[3-[2-(4-butoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 18896403) has the molecular formula C33H34N2O6S and a molecular weight of 586.71 g/mol. Its IUPAC name is 6-[[3-[2-(4-butoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[3-[2-(4-butoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18896403 |
| Molecular Formula | C33H34N2O6S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 6-[[3-[2-(4-butoxycarbonylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)C3CC=CCC3C(=O)O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H34N2O6S/c1-2-3-20-41-33(40)23-16-18-24(19-17-23)34-31(37)29(22-10-5-4-6-11-22)42-26-13-9-12-25(21-26)35-30(36)27-14-7-8-15-28(27)32(38)39/h4-13,16-19,21,27-29H,2-3,14-15,20H2,1H3,(H,34,37)(H,35,36)(H,38,39) |
| InChIKey | GXPFBAPBVTZKSU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|