C38H35N3O4S2 — CID 18908703
butyl 4-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 18908703) has the molecular formula C38H35N3O4S2 and a molecular weight of 661.85 g/mol. Its IUPAC name is butyl 4-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 18908703 |
| Molecular Formula | C38H35N3O4S2 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.21 |
| IUPAC Name | butyl 4-[[2-[3-(4a,10a-dihydrophenothiazine-10-carbonylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)N3c4ccccc4SC4C=CC=CC43)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H35N3O4S2/c1-2-3-24-45-37(43)27-20-22-28(23-21-27)39-36(42)35(26-12-5-4-6-13-26)46-30-15-11-14-29(25-30)40-38(44)41-31-16-7-9-18-33(31)47-34-19-10-8-17-32(34)41/h4-23,25,31,33,35H,2-3,24H2,1H3,(H,39,42)(H,40,44) |
| InChIKey | VKSWOLAKDHMIIV-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|