C24H25ClN2O5S — CID 22785670
6-[[4-[1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22785670) has the molecular formula C24H25ClN2O5S and a molecular weight of 488.99 g/mol. Its IUPAC name is 6-[[4-[1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22785670 |
| Molecular Formula | C24H25ClN2O5S |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 6-[[4-[1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(C)Sc1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1 |
| InChI | InChI=1S/C24H25ClN2O5S/c1-14(22(28)27-20-13-15(25)7-12-21(20)32-2)33-17-10-8-16(9-11-17)26-23(29)18-5-3-4-6-19(18)24(30)31/h3-4,7-14,18-19H,5-6H2,1-2H3,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | ZVMHNZQAOMDSQD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|