C27H32N2O5S — CID 22785664
6-[[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 22785664) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is 6-[[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22785664 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 6-[[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCCOc1ccc(NC(=O)C(C)Sc2ccc(NC(=O)C3CC=CCC3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O5S/c1-3-4-17-34-21-13-9-19(10-14-21)28-25(30)18(2)35-22-15-11-20(12-16-22)29-26(31)23-7-5-6-8-24(23)27(32)33/h5-6,9-16,18,23-24H,3-4,7-8,17H2,1-2H3,(H,28,30)(H,29,31)(H,32,33) |
| InChIKey | ISDFCYXAURWWFB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|