C22H20FNO2S — CID 7228798
(2R)-N-(2-ethoxyphenyl)-2-(4-fluorophenyl)sulfanyl-2-phenylacetamide (PubChem CID 7228798) has the molecular formula C22H20FNO2S and a molecular weight of 381.47 g/mol. Its IUPAC name is (2R)-N-(2-ethoxyphenyl)-2-(4-fluorophenyl)sulfanyl-2-phenylacetamide.
| Compound Name | (2R)-N-(2-ethoxyphenyl)-2-(4-fluorophenyl)sulfanyl-2-phenylacetamide |
|---|---|
| PubChem CID | 7228798 |
| Molecular Formula | C22H20FNO2S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | (2R)-N-(2-ethoxyphenyl)-2-(4-fluorophenyl)sulfanyl-2-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H](Sc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H20FNO2S/c1-2-26-20-11-7-6-10-19(20)24-22(25)21(16-8-4-3-5-9-16)27-18-14-12-17(23)13-15-18/h3-15,21H,2H2,1H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | KQRPTBKNRKHPAA-OAQYLSRUSA-N |
| XLogP | 5.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |