C22H29N3O7 — CID 177389258
diethyl 2-[(R)-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]-(4-methoxyphenyl)methyl]propanedioate (PubChem CID 177389258) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is diethyl 2-[(R)-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]-(4-methoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[(R)-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]-(4-methoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 177389258 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | diethyl 2-[(R)-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]-(4-methoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](Nc1nccc(C(OC)OC)n1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29N3O7/c1-6-31-19(26)17(20(27)32-7-2)18(14-8-10-15(28-3)11-9-14)25-22-23-13-12-16(24-22)21(29-4)30-5/h8-13,17-18,21H,6-7H2,1-5H3,(H,23,24,25)/t18-/m0/s1 |
| InChIKey | BHQXOENGWJHPHS-SFHVURJKSA-N |
| XLogP | 2.67 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|