C21H33N3O6 — CID 177432735
diethyl 2-[(R)-cyclohexyl-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]methyl]propanedioate (PubChem CID 177432735) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is diethyl 2-[(R)-cyclohexyl-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]methyl]propanedioate.
| Compound Name | diethyl 2-[(R)-cyclohexyl-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]methyl]propanedioate |
|---|---|
| PubChem CID | 177432735 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | diethyl 2-[(R)-cyclohexyl-[[4-(dimethoxymethyl)pyrimidin-2-yl]amino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](Nc1nccc(C(OC)OC)n1)C1CCCCC1 |
| InChI | InChI=1S/C21H33N3O6/c1-5-29-18(25)16(19(26)30-6-2)17(14-10-8-7-9-11-14)24-21-22-13-12-15(23-21)20(27-3)28-4/h12-14,16-17,20H,5-11H2,1-4H3,(H,22,23,24)/t17-/m1/s1 |
| InChIKey | VQBZIOYGRYSKEY-QGZVFWFLSA-N |
| XLogP | 2.87 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|