C28H44O6 — CID 69230800
bis(2-ethylhexyl) 2-hydroxy-3-[(4-methoxyphenyl)methylidene]butanedioate (PubChem CID 69230800) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-hydroxy-3-[(4-methoxyphenyl)methylidene]butanedioate.
| Compound Name | bis(2-ethylhexyl) 2-hydroxy-3-[(4-methoxyphenyl)methylidene]butanedioate |
|---|---|
| PubChem CID | 69230800 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | bis(2-ethylhexyl) 2-hydroxy-3-[(4-methoxyphenyl)methylidene]butanedioate |
| SMILES | CCCCC(CC)COC(=O)C(=Cc1ccc(OC)cc1)C(O)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C28H44O6/c1-6-10-12-21(8-3)19-33-27(30)25(18-23-14-16-24(32-5)17-15-23)26(29)28(31)34-20-22(9-4)13-11-7-2/h14-18,21-22,26,29H,6-13,19-20H2,1-5H3 |
| InChIKey | GUNLLPLDRNCRCW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|