C20H26N2O3 — CID 58931973
2-ethylhexyl (Z)-3-(4-acetamidophenyl)-2-isocyanoprop-2-enoate (PubChem CID 58931973) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-ethylhexyl (Z)-3-(4-acetamidophenyl)-2-isocyanoprop-2-enoate.
| Compound Name | 2-ethylhexyl (Z)-3-(4-acetamidophenyl)-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 58931973 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-ethylhexyl (Z)-3-(4-acetamidophenyl)-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc(NC(C)=O)cc1)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C20H26N2O3/c1-5-7-8-16(6-2)14-25-20(24)19(21-4)13-17-9-11-18(12-10-17)22-15(3)23/h9-13,16H,5-8,14H2,1-3H3,(H,22,23)/b19-13- |
| InChIKey | MSWGKZSGGMJQGD-UYRXBGFRSA-N |
| XLogP | 4.66 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|