C27H30N2O2 — CID 140795114
2-ethylhexyl (Z)-2-isocyano-3-(1-methyl-2-phenylindol-3-yl)prop-2-enoate (PubChem CID 140795114) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-ethylhexyl (Z)-2-isocyano-3-(1-methyl-2-phenylindol-3-yl)prop-2-enoate.
| Compound Name | 2-ethylhexyl (Z)-2-isocyano-3-(1-methyl-2-phenylindol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 140795114 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-ethylhexyl (Z)-2-isocyano-3-(1-methyl-2-phenylindol-3-yl)prop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1c(-c2ccccc2)n(C)c2ccccc12)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C27H30N2O2/c1-5-7-13-20(6-2)19-31-27(30)24(28-3)18-23-22-16-11-12-17-25(22)29(4)26(23)21-14-9-8-10-15-21/h8-12,14-18,20H,5-7,13,19H2,1-2,4H3/b24-18- |
| InChIKey | IXDTZEFUBUPHBW-MOHJPFBDSA-N |
| XLogP | 6.87 |
| TPSA | 35.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|