C48H72O10 — CID 160963893
bis(2-ethylhexyl) 2-[(4-methoxyphenyl)methylidene]propanedioate;bis(2-methylbutyl) 2-[(4-methoxyphenyl)methylidene]propanedioate (PubChem CID 160963893) has the molecular formula C48H72O10 and a molecular weight of 809.09 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-[(4-methoxyphenyl)methylidene]propanedioate;bis(2-methylbutyl) 2-[(4-methoxyphenyl)methylidene]propanedioate.
| Compound Name | bis(2-ethylhexyl) 2-[(4-methoxyphenyl)methylidene]propanedioate;bis(2-methylbutyl) 2-[(4-methoxyphenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 160963893 |
| Molecular Formula | C48H72O10 |
| Molecular Weight | 809.09 g/mol |
| Exact Mass | 808.51 |
| IUPAC Name | bis(2-ethylhexyl) 2-[(4-methoxyphenyl)methylidene]propanedioate;bis(2-methylbutyl) 2-[(4-methoxyphenyl)methylidene]propanedioate |
| SMILES | CCC(C)COC(=O)C(=Cc1ccc(OC)cc1)C(=O)OCC(C)CC.CCCCC(CC)COC(=O)C(=Cc1ccc(OC)cc1)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C27H42O5.C21H30O5/c1-6-10-12-21(8-3)19-31-26(28)25(18-23-14-16-24(30-5)17-15-23)27(29)32-20-22(9-4)13-11-7-2;1-6-15(3)13-25-20(22)19(21(23)26-14-16(4)7-2)12-17-8-10-18(24-5)11-9-17/h14-18,21-22H,6-13,19-20H2,1-5H3;8-12,15-16H,6-7,13-14H2,1-5H3 |
| InChIKey | SXJBWZZAHKVFTM-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.09 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|