C23H36O5 — CID 160746832
methane;1-O-(2-methylbutyl) 3-O-(2-methylpentyl) (2Z)-2-[(4-methoxyphenyl)methylidene]propanedioate (PubChem CID 160746832) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is methane;1-O-(2-methylbutyl) 3-O-(2-methylpentyl) (2Z)-2-[(4-methoxyphenyl)methylidene]propanedioate.
| Compound Name | methane;1-O-(2-methylbutyl) 3-O-(2-methylpentyl) (2Z)-2-[(4-methoxyphenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 160746832 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | methane;1-O-(2-methylbutyl) 3-O-(2-methylpentyl) (2Z)-2-[(4-methoxyphenyl)methylidene]propanedioate |
| SMILES | C.CCCC(C)COC(=O)/C(=C\c1ccc(OC)cc1)C(=O)OCC(C)CC |
| InChI | InChI=1S/C22H32O5.CH4/c1-6-8-17(4)15-27-22(24)20(21(23)26-14-16(3)7-2)13-18-9-11-19(25-5)12-10-18;/h9-13,16-17H,6-8,14-15H2,1-5H3;1H4/b20-13-; |
| InChIKey | RWHHNYHNMSGVNO-MASIZSFYSA-N |
| XLogP | 5.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|