C29H28O3 — CID 135035032
ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(4-methoxyphenyl)-3-methylidenepent-4-enoate (PubChem CID 135035032) has the molecular formula C29H28O3 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(4-methoxyphenyl)-3-methylidenepent-4-enoate.
| Compound Name | ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(4-methoxyphenyl)-3-methylidenepent-4-enoate |
|---|---|
| PubChem CID | 135035032 |
| Molecular Formula | C29H28O3 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(4-methoxyphenyl)-3-methylidenepent-4-enoate |
| SMILES | C=C(/C(=C/c1ccccc1)C(=O)OCC)/C(=C/c1ccc(OC)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H28O3/c1-4-32-29(30)28(21-24-13-9-6-10-14-24)22(2)26(19-23-11-7-5-8-12-23)20-25-15-17-27(31-3)18-16-25/h5-18,20-21H,2,4,19H2,1,3H3/b26-20+,28-21- |
| InChIKey | AQPSRLFHTUMZPW-VQGSXRGESA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|