About diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole
diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole (PubChem CID 174971143) has the molecular formula C28H27NO4
and a molecular weight of 441.53 g/mol. Its IUPAC name is diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole.
Molecular Properties
| Compound Name | diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole |
| PubChem CID | 174971143 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole |
| SMILES | C=Cn1c2ccccc2c2ccccc21.CCOC(=O)C(=Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C14H11N.C14H16O4/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11/h2-10H,1H2;5-10H,3-4H2,1-2H3 |
| InChIKey | IGZHMBHHBULXTD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole?
The IUPAC name of diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole (CID 174971143) is diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole.
What is the SMILES notation for diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole?
The canonical SMILES for diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole is C=Cn1c2ccccc2c2ccccc21.CCOC(=O)C(=Cc1ccccc1)C(=O)OCC.
What is the InChIKey of diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole?
The InChIKey is IGZHMBHHBULXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C14H16O4/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11/h2-10H,1H2;5-10H,3-4H2,1-2H3.
What are the key properties of diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole?
diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole has a molecular weight of 441.53 g/mol, XLogP of 6.09, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-benzylidenepropanedioate;9-ethenylcarbazole is sourced from PubChem (CID 174971143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).