About 9-ethenylcarbazole;dihydrochloride
9-ethenylcarbazole;dihydrochloride (PubChem CID 90094696) has the molecular formula C14H13Cl2N
and a molecular weight of 266.17 g/mol. Its IUPAC name is 9-ethenylcarbazole;dihydrochloride.
Molecular Properties
| Compound Name | 9-ethenylcarbazole;dihydrochloride |
| PubChem CID | 90094696 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 9-ethenylcarbazole;dihydrochloride |
| SMILES | C=Cn1c2ccccc2c2ccccc21.Cl.Cl |
| InChI | InChI=1S/C14H11N.2ClH/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;;/h2-10H,1H2;2*1H |
| InChIKey | YGVASVLICMKBGA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-ethenylcarbazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylcarbazole;dihydrochloride?
The IUPAC name of 9-ethenylcarbazole;dihydrochloride (CID 90094696) is 9-ethenylcarbazole;dihydrochloride.
What is the SMILES notation for 9-ethenylcarbazole;dihydrochloride?
The canonical SMILES for 9-ethenylcarbazole;dihydrochloride is C=Cn1c2ccccc2c2ccccc21.Cl.Cl.
What is the InChIKey of 9-ethenylcarbazole;dihydrochloride?
The InChIKey is YGVASVLICMKBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.2ClH/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;;/h2-10H,1H2;2*1H.
What are the key properties of 9-ethenylcarbazole;dihydrochloride?
9-ethenylcarbazole;dihydrochloride has a molecular weight of 266.17 g/mol, XLogP of 4.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylcarbazole;dihydrochloride is sourced from PubChem (CID 90094696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).