C28H25ClO2 — CID 135035028
ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(3-chlorophenyl)-3-methylidenepent-4-enoate (PubChem CID 135035028) has the molecular formula C28H25ClO2 and a molecular weight of 428.96 g/mol. Its IUPAC name is ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(3-chlorophenyl)-3-methylidenepent-4-enoate.
| Compound Name | ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(3-chlorophenyl)-3-methylidenepent-4-enoate |
|---|---|
| PubChem CID | 135035028 |
| Molecular Formula | C28H25ClO2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | ethyl (E,2Z)-4-benzyl-2-benzylidene-5-(3-chlorophenyl)-3-methylidenepent-4-enoate |
| SMILES | C=C(/C(=C/c1ccccc1)C(=O)OCC)/C(=C/c1cccc(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C28H25ClO2/c1-3-31-28(30)27(20-23-13-8-5-9-14-23)21(2)25(17-22-11-6-4-7-12-22)18-24-15-10-16-26(29)19-24/h4-16,18-20H,2-3,17H2,1H3/b25-18+,27-20- |
| InChIKey | ZWMXVHMDSONMOZ-STORODAOSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|