C22H26O11 — CID 173266479
[1-(2,5-dimethoxybenzoyl)peroxy-2-ethoxyethyl] 2,5-dimethoxybenzenecarboperoxoate (PubChem CID 173266479) has the molecular formula C22H26O11 and a molecular weight of 466.44 g/mol. Its IUPAC name is [1-(2,5-dimethoxybenzoyl)peroxy-2-ethoxyethyl] 2,5-dimethoxybenzenecarboperoxoate.
| Compound Name | [1-(2,5-dimethoxybenzoyl)peroxy-2-ethoxyethyl] 2,5-dimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266479 |
| Molecular Formula | C22H26O11 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [1-(2,5-dimethoxybenzoyl)peroxy-2-ethoxyethyl] 2,5-dimethoxybenzenecarboperoxoate |
| SMILES | CCOCC(OOC(=O)c1cc(OC)ccc1OC)OOC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C22H26O11/c1-6-29-13-20(30-32-21(23)16-11-14(25-2)7-9-18(16)27-4)31-33-22(24)17-12-15(26-3)8-10-19(17)28-5/h7-12,20H,6,13H2,1-5H3 |
| InChIKey | SEQGBIXRBGXVPB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|