C16H16OS — CID 12660448
1,3,5-trimethyl-2-[phenyl(sulfinyl)methyl]benzene (PubChem CID 12660448) has the molecular formula C16H16OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[phenyl(sulfinyl)methyl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[phenyl(sulfinyl)methyl]benzene |
|---|---|
| PubChem CID | 12660448 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1,3,5-trimethyl-2-[phenyl(sulfinyl)methyl]benzene |
| SMILES | Cc1cc(C)c(C(=S=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H16OS/c1-11-9-12(2)15(13(3)10-11)16(18-17)14-7-5-4-6-8-14/h4-10H,1-3H3 |
| InChIKey | KVFOOGWIZSBOHP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|