C33H35O2P — CID 10983851
1,3,5-trimethyl-2-[2-[methyl(phenyl)phosphoryl]oxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethenyl]benzene (PubChem CID 10983851) has the molecular formula C33H35O2P and a molecular weight of 494.62 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[2-[methyl(phenyl)phosphoryl]oxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethenyl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[2-[methyl(phenyl)phosphoryl]oxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 10983851 |
| Molecular Formula | C33H35O2P |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 1,3,5-trimethyl-2-[2-[methyl(phenyl)phosphoryl]oxy-2-phenyl-1-(2,4,6-trimethylphenyl)ethenyl]benzene |
| SMILES | Cc1cc(C)c(C(=C(OP(C)(=O)c2ccccc2)c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C33H35O2P/c1-22-18-24(3)30(25(4)19-22)32(31-26(5)20-23(2)21-27(31)6)33(28-14-10-8-11-15-28)35-36(7,34)29-16-12-9-13-17-29/h8-21H,1-7H3 |
| InChIKey | HUCFHMQCNOUVMB-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|