C16H17O3P — CID 54401918
[methyl(phenyl)phosphoryl] 2,6-dimethylbenzoate (PubChem CID 54401918) has the molecular formula C16H17O3P and a molecular weight of 288.28 g/mol. Its IUPAC name is [methyl(phenyl)phosphoryl] 2,6-dimethylbenzoate.
| Compound Name | [methyl(phenyl)phosphoryl] 2,6-dimethylbenzoate |
|---|---|
| PubChem CID | 54401918 |
| Molecular Formula | C16H17O3P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [methyl(phenyl)phosphoryl] 2,6-dimethylbenzoate |
| SMILES | Cc1cccc(C)c1C(=O)OP(C)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17O3P/c1-12-8-7-9-13(2)15(12)16(17)19-20(3,18)14-10-5-4-6-11-14/h4-11H,1-3H3 |
| InChIKey | VOABNQPWNPIGDI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|