C14H18O2 — CID 62029854
2-prop-2-enoxy-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 62029854) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-prop-2-enoxy-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-prop-2-enoxy-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 62029854 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-prop-2-enoxy-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | C=CCOCC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H18O2/c1-5-6-16-9-13(15)14-11(3)7-10(2)8-12(14)4/h5,7-8H,1,6,9H2,2-4H3 |
| InChIKey | SCEMXPXONNMDRY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|