C14H18O2 — CID 62031383
2-but-3-enoxy-1-(2,4-dimethylphenyl)ethanone (PubChem CID 62031383) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-but-3-enoxy-1-(2,4-dimethylphenyl)ethanone.
| Compound Name | 2-but-3-enoxy-1-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 62031383 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-but-3-enoxy-1-(2,4-dimethylphenyl)ethanone |
| SMILES | C=CCCOCC(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H18O2/c1-4-5-8-16-10-14(15)13-7-6-11(2)9-12(13)3/h4,6-7,9H,1,5,8,10H2,2-3H3 |
| InChIKey | ATCGBKUWVOCTIB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|