C12H15NO3 — CID 43139027
5-ethoxy-1-pyridin-4-ylpentane-1,3-dione (PubChem CID 43139027) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-ethoxy-1-pyridin-4-ylpentane-1,3-dione.
| Compound Name | 5-ethoxy-1-pyridin-4-ylpentane-1,3-dione |
|---|---|
| PubChem CID | 43139027 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 5-ethoxy-1-pyridin-4-ylpentane-1,3-dione |
| SMILES | CCOCCC(=O)CC(=O)c1ccncc1 |
| InChI | InChI=1S/C12H15NO3/c1-2-16-8-5-11(14)9-12(15)10-3-6-13-7-4-10/h3-4,6-7H,2,5,8-9H2,1H3 |
| InChIKey | LOXBBEGYYBEBEI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|