C13H15FO3 — CID 43138983
5-ethoxy-1-(4-fluorophenyl)pentane-1,3-dione (PubChem CID 43138983) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is 5-ethoxy-1-(4-fluorophenyl)pentane-1,3-dione.
| Compound Name | 5-ethoxy-1-(4-fluorophenyl)pentane-1,3-dione |
|---|---|
| PubChem CID | 43138983 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-ethoxy-1-(4-fluorophenyl)pentane-1,3-dione |
| SMILES | CCOCCC(=O)CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FO3/c1-2-17-8-7-12(15)9-13(16)10-3-5-11(14)6-4-10/h3-6H,2,7-9H2,1H3 |
| InChIKey | ZGWNTUDPXNYSEJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|