C13H18O4S — CID 62111836
4,4-diethoxy-1-(5-methylthiophen-2-yl)butane-1,3-dione (PubChem CID 62111836) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4,4-diethoxy-1-(5-methylthiophen-2-yl)butane-1,3-dione.
| Compound Name | 4,4-diethoxy-1-(5-methylthiophen-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 62111836 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4,4-diethoxy-1-(5-methylthiophen-2-yl)butane-1,3-dione |
| SMILES | CCOC(OCC)C(=O)CC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C13H18O4S/c1-4-16-13(17-5-2)11(15)8-10(14)12-7-6-9(3)18-12/h6-7,13H,4-5,8H2,1-3H3 |
| InChIKey | BJZVHJOSAWNZDY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|