C14H16N2O3S — CID 110722088
N-[2-(1,3-oxazol-4-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 110722088) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[2-(1,3-oxazol-4-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-[2-(1,3-oxazol-4-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 110722088 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[2-(1,3-oxazol-4-yl)ethyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(NCCc1cocn1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H16N2O3S/c17-20(18,16-7-6-13-9-19-10-15-13)14-5-4-11-2-1-3-12(11)8-14/h4-5,8-10,16H,1-3,6-7H2 |
| InChIKey | OESLCTRZJCNPSJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |