C14H15NO3S — CID 47204540
N-(furan-3-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 47204540) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(furan-3-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 47204540 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(furan-3-ylmethyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(NCc1ccoc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H15NO3S/c16-19(17,15-9-11-6-7-18-10-11)14-5-4-12-2-1-3-13(12)8-14/h4-8,10,15H,1-3,9H2 |
| InChIKey | IHYWBGBYESWILF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |