C13H14ClNO3S — CID 115588808
4-(2-chloroethyl)-N-(furan-3-ylmethyl)benzenesulfonamide (PubChem CID 115588808) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-(furan-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-(furan-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115588808 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-(2-chloroethyl)-N-(furan-3-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccoc1)c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C13H14ClNO3S/c14-7-5-11-1-3-13(4-2-11)19(16,17)15-9-12-6-8-18-10-12/h1-4,6,8,10,15H,5,7,9H2 |
| InChIKey | OKDBRGCEWFXFOK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|