C15H18N2O2S — CID 110716386
N-(2-pyrrol-1-ylethyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 110716386) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(2-pyrrol-1-ylethyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-pyrrol-1-ylethyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 110716386 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(2-pyrrol-1-ylethyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(NCCn1cccc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H18N2O2S/c18-20(19,16-8-11-17-9-1-2-10-17)15-7-6-13-4-3-5-14(13)12-15/h1-2,6-7,9-10,12,16H,3-5,8,11H2 |
| InChIKey | NHPJFAJGTRGBON-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |