C12H10Cl3NO3S3 — CID 139687198
N-[2-[5-(2,2,2-trichloroacetyl)thiophen-3-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 139687198) has the molecular formula C12H10Cl3NO3S3 and a molecular weight of 418.78 g/mol. Its IUPAC name is N-[2-[5-(2,2,2-trichloroacetyl)thiophen-3-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[5-(2,2,2-trichloroacetyl)thiophen-3-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 139687198 |
| Molecular Formula | C12H10Cl3NO3S3 |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 416.89 |
| IUPAC Name | N-[2-[5-(2,2,2-trichloroacetyl)thiophen-3-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1cc(CCNS(=O)(=O)c2cccs2)cs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H10Cl3NO3S3/c13-12(14,15)11(17)9-6-8(7-21-9)3-4-16-22(18,19)10-2-1-5-20-10/h1-2,5-7,16H,3-4H2 |
| InChIKey | ZKQZXTSLTXWBKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|