C12H14N4O4S2 — CID 133397523
N-[2-[(6-methyl-5-nitro-2-pyridinyl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133397523) has the molecular formula C12H14N4O4S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-[(6-methyl-5-nitro-2-pyridinyl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-methyl-5-nitro-2-pyridinyl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133397523 |
| Molecular Formula | C12H14N4O4S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[2-[(6-methyl-5-nitro-2-pyridinyl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2cccs2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O4S2/c1-9-10(16(17)18)4-5-11(15-9)13-6-7-14-22(19,20)12-3-2-8-21-12/h2-5,8,14H,6-7H2,1H3,(H,13,15) |
| InChIKey | VVXHUMASAONKJU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|