C11H14N4O4S2 — CID 4775536
N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 4775536) has the molecular formula C11H14N4O4S2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4775536 |
| Molecular Formula | C11H14N4O4S2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1nn(CCNS(=O)(=O)c2cccs2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O4S2/c1-8-11(15(16)17)9(2)14(13-8)6-5-12-21(18,19)10-4-3-7-20-10/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | INLBWDATOLRUOX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|