C11H14N4O2S — CID 75437926
4-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-2-methyl-1,3-thiazole (PubChem CID 75437926) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 75437926 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(CCn2nc(C)c([N+](=O)[O-])c2C)cs1 |
| InChI | InChI=1S/C11H14N4O2S/c1-7-11(15(16)17)8(2)14(13-7)5-4-10-6-18-9(3)12-10/h6H,4-5H2,1-3H3 |
| InChIKey | CFQMBFASNGFUSX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|