C14H21ClN6O3 — CID 120856305
1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride (PubChem CID 120856305) has the molecular formula C14H21ClN6O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is 1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 120856305 |
| Molecular Formula | C14H21ClN6O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclopentan-1-amine;hydrochloride |
| SMILES | Cc1nn(CCc2nc(C3(N)CCCC3)no2)c(C)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H20N6O3.ClH/c1-9-12(20(21)22)10(2)19(17-9)8-5-11-16-13(18-23-11)14(15)6-3-4-7-14;/h3-8,15H2,1-2H3;1H |
| InChIKey | DOKGTGVLTHYBTO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|