C13H18N6O3 — CID 120863792
1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine (PubChem CID 120863792) has the molecular formula C13H18N6O3 and a molecular weight of 306.33 g/mol. Its IUPAC name is 1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine.
| Compound Name | 1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 120863792 |
| Molecular Formula | C13H18N6O3 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[5-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-amine |
| SMILES | Cc1nn(CCc2nc(C3(N)CCC3)no2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N6O3/c1-8-11(19(20)21)9(2)18(16-8)7-4-10-15-12(17-22-10)13(14)5-3-6-13/h3-7,14H2,1-2H3 |
| InChIKey | ATEAHDFFYHVQNS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|