C10H10N4O4S — CID 43664486
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 43664486) has the molecular formula C10H10N4O4S and a molecular weight of 282.28 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 43664486 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | Cc1nn(Cc2csc(C(=O)O)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O4S/c1-5-8(14(17)18)6(2)13(12-5)3-7-4-19-9(11-7)10(15)16/h4H,3H2,1-2H3,(H,15,16) |
| InChIKey | VPHPHEPLBKMZKI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|