C23H28N6O3S — CID 24586705
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 24586705) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 24586705 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)Nc3nc(CN4CCCC(C)C4)cs3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N6O3S/c1-15-5-4-10-27(11-15)13-20-14-33-23(24-20)25-22(30)19-8-6-18(7-9-19)12-28-17(3)21(29(31)32)16(2)26-28/h6-9,14-15H,4-5,10-13H2,1-3H3,(H,24,25,30) |
| InChIKey | DZYQSSAOFSYZNT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|