C17H18N6O3S — CID 8777740
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 8777740) has the molecular formula C17H18N6O3S and a molecular weight of 386.44 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8777740 |
| Molecular Formula | C17H18N6O3S |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCc1nnc(NC(=O)c2ccc(Cn3nc(C)c([N+](=O)[O-])c3C)cc2)s1 |
| InChI | InChI=1S/C17H18N6O3S/c1-4-14-19-20-17(27-14)18-16(24)13-7-5-12(6-8-13)9-22-11(3)15(23(25)26)10(2)21-22/h5-8H,4,9H2,1-3H3,(H,18,20,24) |
| InChIKey | LHLGBLBXDOGMLW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|