C17H18N4O3S2 — CID 31838096
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide (PubChem CID 31838096) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 31838096 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N,N-bis(thiophen-2-ylmethyl)acetamide |
| SMILES | Cc1nn(CC(=O)N(Cc2cccs2)Cc2cccs2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N4O3S2/c1-12-17(21(23)24)13(2)20(18-12)11-16(22)19(9-14-5-3-7-25-14)10-15-6-4-8-26-15/h3-8H,9-11H2,1-2H3 |
| InChIKey | MNJXRUFUGDXRRB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|