C20H26N4O3 — CID 55588793
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)acetamide (PubChem CID 55588793) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 55588793 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-methyl-N-(4-phenylcyclohexyl)acetamide |
| SMILES | Cc1nn(CC(=O)N(C)C2CCC(c3ccccc3)CC2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N4O3/c1-14-20(24(26)27)15(2)23(21-14)13-19(25)22(3)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h4-8,17-18H,9-13H2,1-3H3 |
| InChIKey | NHFVPISMJDXQQN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|