C21H23N5O7 — CID 41093962
ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 41093962) has the molecular formula C21H23N5O7 and a molecular weight of 457.44 g/mol. Its IUPAC name is ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 41093962 |
| Molecular Formula | C21H23N5O7 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)NC(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23N5O7/c1-4-32-20(28)17-15(22-21(29)23-18(17)14-8-6-5-7-9-14)11-33-16(27)10-25-13(3)19(26(30)31)12(2)24-25/h5-9,18H,4,10-11H2,1-3H3,(H2,22,23,29)/t18-/m0/s1 |
| InChIKey | MYNAZRYTGNONFS-SFHVURJKSA-N |
| XLogP | 1.82 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|