C20H18FN3O6 — CID 46484771
ethyl 6-[(2-fluoro-4-nitrophenoxy)methyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 46484771) has the molecular formula C20H18FN3O6 and a molecular weight of 415.38 g/mol. Its IUPAC name is ethyl 6-[(2-fluoro-4-nitrophenoxy)methyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[(2-fluoro-4-nitrophenoxy)methyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 46484771 |
| Molecular Formula | C20H18FN3O6 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 6-[(2-fluoro-4-nitrophenoxy)methyl]-2-oxo-4-phenyl-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COc2ccc([N+](=O)[O-])cc2F)NC(=O)NC1c1ccccc1 |
| InChI | InChI=1S/C20H18FN3O6/c1-2-29-19(25)17-15(11-30-16-9-8-13(24(27)28)10-14(16)21)22-20(26)23-18(17)12-6-4-3-5-7-12/h3-10,18H,2,11H2,1H3,(H2,22,23,26) |
| InChIKey | MKGCKUGVOMAPBX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|