C19H17ClN4O6 — CID 24577638
ethyl 4-(4-chlorophenyl)-6-[(2-nitro-3-pyridinyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 24577638) has the molecular formula C19H17ClN4O6 and a molecular weight of 432.82 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-6-[(2-nitro-3-pyridinyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-6-[(2-nitro-3-pyridinyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 24577638 |
| Molecular Formula | C19H17ClN4O6 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-6-[(2-nitro-3-pyridinyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COc2cccnc2[N+](=O)[O-])NC(=O)NC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN4O6/c1-2-29-18(25)15-13(10-30-14-4-3-9-21-17(14)24(27)28)22-19(26)23-16(15)11-5-7-12(20)8-6-11/h3-9,16H,2,10H2,1H3,(H2,22,23,26) |
| InChIKey | PHKDXSZTLRCDHE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|