C16H21N5O7 — CID 40987314
ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 40987314) has the molecular formula C16H21N5O7 and a molecular weight of 395.37 g/mol. Its IUPAC name is ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 40987314 |
| Molecular Formula | C16H21N5O7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl (4S)-6-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)NC(=O)N[C@H]1C |
| InChI | InChI=1S/C16H21N5O7/c1-5-27-15(23)13-8(2)17-16(24)18-11(13)7-28-12(22)6-20-10(4)14(21(25)26)9(3)19-20/h8H,5-7H2,1-4H3,(H2,17,18,24)/t8-/m0/s1 |
| InChIKey | JNNAIUMVSOFKLA-QMMMGPOBSA-N |
| XLogP | 0.47 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|