C17H19N3O7 — CID 7795012
ethyl (4S)-4-methyl-6-[(2-methyl-3-nitrobenzoyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7795012) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is ethyl (4S)-4-methyl-6-[(2-methyl-3-nitrobenzoyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-methyl-6-[(2-methyl-3-nitrobenzoyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7795012 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | ethyl (4S)-4-methyl-6-[(2-methyl-3-nitrobenzoyl)oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)c2cccc([N+](=O)[O-])c2C)NC(=O)N[C@H]1C |
| InChI | InChI=1S/C17H19N3O7/c1-4-26-16(22)14-10(3)18-17(23)19-12(14)8-27-15(21)11-6-5-7-13(9(11)2)20(24)25/h5-7,10H,4,8H2,1-3H3,(H2,18,19,23)/t10-/m0/s1 |
| InChIKey | HJSDRDRXCQTJLK-JTQLQIEISA-N |
| XLogP | 1.58 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|