C20H20N4O9 — CID 40943624
ethyl (4S)-4-methyl-6-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 40943624) has the molecular formula C20H20N4O9 and a molecular weight of 460.40 g/mol. Its IUPAC name is ethyl (4S)-4-methyl-6-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-methyl-6-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 40943624 |
| Molecular Formula | C20H20N4O9 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | ethyl (4S)-4-methyl-6-[3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoyloxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)NC(=O)N[C@H]1C |
| InChI | InChI=1S/C20H20N4O9/c1-3-32-19(28)15-10(2)21-20(29)22-12(15)9-33-14(25)7-8-23-17(26)11-5-4-6-13(24(30)31)16(11)18(23)27/h4-6,10H,3,7-9H2,1-2H3,(H2,21,22,29)/t10-/m0/s1 |
| InChIKey | LJAQDVJBOVDABL-JTQLQIEISA-N |
| XLogP | 0.64 |
| TPSA | 174.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|