C26H26N4O10 — CID 98290929
ethyl (4S)-4-(furan-2-yl)-6-[[(2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 98290929) has the molecular formula C26H26N4O10 and a molecular weight of 554.51 g/mol. Its IUPAC name is ethyl (4S)-4-(furan-2-yl)-6-[[(2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-(furan-2-yl)-6-[[(2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 98290929 |
| Molecular Formula | C26H26N4O10 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | ethyl (4S)-4-(furan-2-yl)-6-[[(2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoyl]oxymethyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COC(=O)[C@@H](CC(C)C)N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)NC(=O)N[C@@H]1c1ccco1 |
| InChI | InChI=1S/C26H26N4O10/c1-4-38-25(34)20-15(27-26(35)28-21(20)18-9-6-10-39-18)12-40-24(33)17(11-13(2)3)29-22(31)14-7-5-8-16(30(36)37)19(14)23(29)32/h5-10,13,17,21H,4,11-12H2,1-3H3,(H2,27,28,35)/t17-,21-/m1/s1 |
| InChIKey | PDJCAYYFHUHFBL-DYESRHJHSA-N |
| XLogP | 2.61 |
| TPSA | 187.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|