C22H27N3O7 — CID 30552903
[2-(cyclohexylamino)-2-oxoethyl] (2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 30552903) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] (2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] (2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 30552903 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] (2R)-4-methyl-2-(4-nitro-1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | CC(C)C[C@H](C(=O)OCC(=O)NC1CCCCC1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C22H27N3O7/c1-13(2)11-17(22(29)32-12-18(26)23-14-7-4-3-5-8-14)24-20(27)15-9-6-10-16(25(30)31)19(15)21(24)28/h6,9-10,13-14,17H,3-5,7-8,11-12H2,1-2H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | AQDPTWRSPUBLCN-QGZVFWFLSA-N |
| XLogP | 2.60 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|